1-(4-Methyl-2,5-dimethoxyphenyl)propan-2-amine hydrochloride

1-(4-methyl-2,5-dimethoxyphenyl)propan-2-amine hydrochloride

IUPAC Name: 1-(4-methyl-2,5-dimethoxyphenyl)propan-2-amine hydrochloride

Type: organic

Formula: CH3(CH3O)2C6H2CH2CH(NH2)CH3·HCl

Molecular Formula: C12H20ClNO2

Molar mass: 245.75 g/mol

CAS RN: 15588-95-1

Synonyms

Melting Point