1-(4-Bromo-2,5-dimethoxyphenyl)propan-2-amine hydrochloride

1-(4-bromo-2,5-dimethoxyphenyl)propan-2-amine hydrochloride

IUPAC Name: 1-(4-bromo-2,5-dimethoxyphenyl)propan-2-amine hydrochloride

Type: organic

Formula: Br(CH3O)2C6H2CH2CH(NH2)CH3·HCl

Molecular Formula: C11H17BrClNO2

Molar mass: 310.619 g/mol

CAS RN: 64638-07-9

Synonyms

Melting Point