Trihexyphenidyl hydrochloride

trihexyphenidyl hydrochloride

IUPAC Name: trihexyphenidyl hydrochloride

Type: organic

Formula: C6H11C(C6H5)(OH)CH2CH2N(CH2CH2)2CH2·HCl

Molecular Formula: C20H32ClNO

Molar mass: 337.935 g/mol

CAS RN: 144-11-6

Synonyms

Melting Point